Drugs present in MMsINC which are similar to the molecule MMscode: MMs01304390
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725190 | Clc1cc(O)c(cc1S(=O)(=O)N)C(=O)Nc1c(cccc1C)C | 0.78 |
MMs01724806 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01725741 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01724812 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.71 |
MMs01725319 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.71 |