Drugs present in MMsINC which are similar to the molecule MMscode: MMs01289850
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.75 |
MMs01726941![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.75 |
MMs01727531![]() | S1c2c(cc(S(=O)(=O)N(C)C)cc2)\C(\c2c1cccc2)=C\CCN1CCN(CC1)C | 0.72 |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.70 |
MMs01725221![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.70 |
MMs01726924![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.70 |