Drugs present in MMsINC which are similar to the molecule MMscode: MMs01289728
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.78 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.76 |
MMs01726817![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.73 |
MMs01726814![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.73 |
MMs01726815![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.73 |
MMs01726816![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.73 |
MMs01725108![]() | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.71 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |