Drugs present in MMsINC which are similar to the molecule MMscode: MMs01283845
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725159![]() | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)CCNC(=O)c1noc(c1)C | 0.78 |
MMs01725489![]() | Clc1ccccc1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.71 |
MMs01726492![]() | Clc1ccccc1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.71 |
MMs01726494![]() | Clc1ccccc1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.71 |
MMs01726496![]() | Clc1ccccc1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.71 |







