Drugs present in MMsINC which are similar to the molecule MMscode: MMs01243335
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.75 |
MMs01725668![]() | Oc1ccc(cc1)CC(N)C | 0.73 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.72 |
MMs01725023![]() | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01725662![]() | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01725664![]() | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01724903![]() | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01724895![]() | Oc1cc(ccc1\C=C\c1ccc(cc1)C(N)=N)C(N)=N | 0.70 |