Drugs present in MMsINC which are similar to the molecule MMscode: MMs01219356
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.77 |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.77 |
MMs01725443![]() | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.75 |
MMs01725429![]() | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.75 |
MMs01725112![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.75 |
MMs01724747![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.75 |
MMs01725411![]() | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.74 |
MMs01726844![]() | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.74 |
MMs01726842![]() | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.74 |
MMs01725102![]() | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01725100![]() | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01725162![]() | Clc1cc2c(cc1)C(c1ncccc1CC2)=C1CCN(CC1)C(OCC)=O | 0.71 |