Drugs present in MMsINC which are similar to the molecule MMscode: MMs01209620
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.79 |
MMs01724735![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.77 |
MMs01725288![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.77 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |