Drugs present in MMsINC which are similar to the molecule MMscode: MMs01185227
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725872![]() | O(CC)c1nc2c(n1Cc1ccc(cc1)-c1ccccc1-c1[nH]nnn1)c(ccc2)C(O)=O | 0.77 |
MMs01726758![]() | Fc1ccc(cc1)C(=O)c1cc2[nH]c(nc2cc1)NC(OC)=O | 0.75 |
MMs01724893![]() | Fc1cc2c(-n3c(CN(C)C2=O)c(nc3)C(OCC)=O)cc1 | 0.73 |
MMs01725449![]() | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.72 |
MMs01725638![]() | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.71 |
MMs01725790![]() | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.71 |
MMs01727026![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.70 |
MMs01725239![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.70 |
MMs01725868![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.70 |
MMs01727024![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.70 |












