Drugs present in MMsINC which are similar to the molecule MMscode: MMs01176129
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725141![]() | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.80 |
MMs01726141![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.76 |
MMs01726139![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.76 |
MMs01726143![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.76 |
MMs01725416![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.75 |
MMs01725098![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.75 |
MMs01724762![]() | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.75 |
MMs01725203![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.72 |
MMs01725418![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.72 |
MMs01725860![]() | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.72 |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01725443![]() | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.71 |
MMs01725429![]() | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.71 |
MMs01725411![]() | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.70 |