Drugs present in MMsINC which are similar to the molecule MMscode: MMs01168482
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.78 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.74 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.74 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01725991 | Ic1cc(cc(I)c1OCCN(CC)CC)C(=O)c1c2c(oc1CCCC)cccc2 | 0.72 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.70 |
MMs01725329 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.70 |