Drugs present in MMsINC which are similar to the molecule MMscode: MMs01164205
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.81 |
MMs01724735![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.80 |
MMs01725288![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.80 |
MMs01724937![]() | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.73 |
MMs01727233![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.72 |
MMs01727235![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.72 |
MMs01727237![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.72 |
MMs01727239![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.72 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |