Drugs present in MMsINC which are similar to the molecule MMscode: MMs01148534
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725388![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.77 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.75 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.72 |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01727049![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.71 |
MMs01727043![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.71 |
MMs01727045![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.71 |
MMs01727047![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.71 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.71 |
MMs01725763![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725757![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725759![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725761![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
















