Drugs present in MMsINC which are similar to the molecule MMscode: MMs01082708
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |
MMs01725340 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |
MMs01726937 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.70 |
MMs01726938 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.70 |
MMs01726939 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.70 |
MMs01726940 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.70 |