Drugs present in MMsINC which are similar to the molecule MMscode: MMs01065762
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724996![]() | O=C(N(CC)c1cc(ccc1)C=1n2ncc(c2N=CC=1)C#N)C | 0.75 |
MMs01724991![]() | [NH+](CCc1c2cc(ccc2[nH]c1)Cn1ncnc1)(C)C | 0.73 |
MMs01726741![]() | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.73 |
MMs01725694![]() | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.71 |
MMs01725013![]() | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.71 |
MMs01725232![]() | S(=O)(=O)(Nc1cc2cc([nH]c2cc1)C(=O)N1CCN(CC1)c1ncccc1NC(C)C)C | 0.71 |
MMs01725677![]() | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.70 |