Drugs present in MMsINC which are similar to the molecule MMscode: MMs01026177
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724778![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.76 |
MMs01725055![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.75 |
MMs01724862![]() | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.75 |
MMs01725173![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.75 |
MMs01724823![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.74 |
MMs01725165![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.72 |
MMs01724864![]() | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.71 |