Drugs present in MMsINC which are similar to the molecule MMscode: MMs01023467
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724837![]() | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.74 |
MMs01725169![]() | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.71 |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01725362![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01725364![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01725258![]() | Clc1cc(C(=O)NC2CCN(CC2)Cc2ccccc2)c(OC)cc1N | 0.70 |