Drugs present in MMsINC which are similar to the molecule MMscode: MMs00968953
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.80 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.80 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.78 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.72 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01725336![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.70 |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.70 |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.70 |
MMs01725017![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01725331![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.70 |