Drugs present in MMsINC which are similar to the molecule MMscode: MMs00947623
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725495![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.76 |
MMs01725497![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.76 |
MMs01725499![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.76 |
MMs01725501![]() | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.76 |
MMs01724829![]() | s1c2c(cc1C(N(O)C(=O)N)C)cccc2 | 0.72 |