Drugs present in MMsINC which are similar to the molecule MMscode: MMs00943703
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.79 |
MMs01725155 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.72 |
MMs01724760 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.72 |
MMs01725156 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.72 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.70 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.70 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.70 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.70 |