Drugs present in MMsINC which are similar to the molecule MMscode: MMs00942004
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.80 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.74 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01725157 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.73 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.71 |