Drugs present in MMsINC which are similar to the molecule MMscode: MMs00913241
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.77 |
MMs01725868 | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.75 |
MMs01727026 | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.75 |
MMs01726758 | Fc1ccc(cc1)C(=O)c1cc2[nH]c(nc2cc1)NC(OC)=O | 0.75 |
MMs01725061 | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.70 |