Drugs present in MMsINC which are similar to the molecule MMscode: MMs00907450
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725779 | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.76 |
MMs01724724 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.74 |
MMs01725708 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.74 |
MMs01726588 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01726582 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01726584 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01726586 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01725857 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.71 |
MMs01726462 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.71 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.71 |