Drugs present in MMsINC which are similar to the molecule MMscode: MMs00869386
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727463 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.72 |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725781 | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.70 |