Drugs present in MMsINC which are similar to the molecule MMscode: MMs00868221
    			   
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto | 
|---|---|---|
| Drug | SMILES name | Tanimoto | 
| MMs01725154  | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.81 | 
| MMs01725409  | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.76 | 
| MMs01725376  | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.74 | 
| MMs01724795  | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.73 | 
| MMs01724867  | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.72 | 
| MMs01726520  | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.72 | 
| MMs01725451  | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.72 | 
| MMs01726736  | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.71 | 
| MMs01724776  | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.71 | 
| MMs01725859  | Oc1c(O)c(c2c(cc(C)c(-c3c(cc4c(c(C=O)c(O)c(O)c4C(C)C)c3O)C)c2O)c1C(C)C)C=O | 0.70 | 


