Drugs present in MMsINC which are similar to the molecule MMscode: MMs00865962
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726741![]() | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.81 |
MMs01724907![]() | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.74 |
MMs01725089![]() | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.74 |
MMs01724884![]() | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.73 |
MMs01724834![]() | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 0.72 |
MMs01724991![]() | [NH+](CCc1c2cc(ccc2[nH]c1)Cn1ncnc1)(C)C | 0.70 |