Drugs present in MMsINC which are similar to the molecule MMscode: MMs00828324
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724772![]() | O1C(CNC1=O)COc1ccccc1OC | 0.75 |
MMs01725806![]() | O1C(CNC1=O)COc1ccccc1OC | 0.75 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.73 |
MMs01725080![]() | O(CC(O)COC(=O)N)c1ccccc1OC | 0.73 |
MMs01725081![]() | O(CC(O)COC(=O)N)c1ccccc1OC | 0.73 |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.73 |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.73 |
MMs01725721![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.73 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.71 |