Drugs present in MMsINC which are similar to the molecule MMscode: MMs00801265
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.72 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.71 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.71 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.70 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.70 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.70 |