Drugs present in MMsINC which are similar to the molecule MMscode: MMs00774448
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.78 |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.78 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.78 |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.73 |
MMs01726736![]() | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.73 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.73 |
MMs01724776![]() | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.71 |