Drugs present in MMsINC which are similar to the molecule MMscode: MMs00759614
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.73 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.71 |







