Drugs present in MMsINC which are similar to the molecule MMscode: MMs00748898
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.76 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.72 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.72 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.72 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.72 |
MMs01725564 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01725565 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |