Drugs present in MMsINC which are similar to the molecule MMscode: MMs00742106
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.81 |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.77 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.72 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.72 |
MMs01725169 | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.72 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |