Drugs present in MMsINC which are similar to the molecule MMscode: MMs00707152
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.78 |
MMs01724795![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.77 |
MMs01725376![]() | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.77 |
MMs01726520![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.77 |
MMs01724867![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.77 |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.73 |
MMs01726137![]() | OC12C3(CCCC1)CCN(C2Cc1c3cc(O)cc1)CC1CCC1 | 0.72 |
MMs01725077![]() | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.72 |
MMs01725874![]() | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.71 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725753![]() | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.71 |