Drugs present in MMsINC which are similar to the molecule MMscode: MMs00707149
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.72 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |