Drugs present in MMsINC which are similar to the molecule MMscode: MMs00703690
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.81 |
MMs01725947 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.74 |
MMs01726922 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.74 |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.72 |
MMs01724939 | Clc1c(Cl)c(OCC(O)=O)ccc1C(=O)c1sccc1 | 0.71 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01725244 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.70 |
MMs01727463 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.70 |