Drugs present in MMsINC which are similar to the molecule MMscode: MMs00702523
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.81 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.77 |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.73 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01725524 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.72 |
MMs01725525 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.72 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.70 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.70 |