Drugs present in MMsINC which are similar to the molecule MMscode: MMs00691411
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.76 |
MMs01725362 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.76 |
MMs01725364 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.76 |
MMs01725830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.76 |
MMs01724821 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.72 |
MMs01725755 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.72 |