Drugs present in MMsINC which are similar to the molecule MMscode: MMs00688989
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.74 |
MMs01725401![]() | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.72 |
MMs01725402![]() | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.72 |
MMs01725403![]() | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.72 |
MMs01725404![]() | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.72 |
MMs01724772![]() | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01725806![]() | O1C(CNC1=O)COc1ccccc1OC | 0.72 |