Drugs present in MMsINC which are similar to the molecule MMscode: MMs00674862
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.74 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.73 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.72 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.71 |
MMs01726820![]() | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.71 |
MMs01726819![]() | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.71 |
MMs01725459![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01725457![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.71 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.70 |
MMs01725532![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725530![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |