Drugs present in MMsINC which are similar to the molecule MMscode: MMs00638016
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726758![]() | Fc1ccc(cc1)C(=O)c1cc2[nH]c(nc2cc1)NC(OC)=O | 0.81 |
MMs01726139![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01726141![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01726143![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01725872![]() | O(CC)c1nc2c(n1Cc1ccc(cc1)-c1ccccc1-c1[nH]nnn1)c(ccc2)C(O)=O | 0.71 |
MMs01727026![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.70 |
MMs01725868![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.70 |