Drugs present in MMsINC which are similar to the molecule MMscode: MMs00629776
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724851![]() | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.85 |
MMs01724853![]() | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.83 |
MMs01724959![]() | Clc1cccc(Cl)c1N(CC=C)C1=[NH+]CCN1 | 0.75 |
MMs01724865![]() | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.73 |
MMs01725291![]() | Clc1cccc(Cl)c1N=C1NCCN1 | 0.71 |
MMs01725089![]() | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.71 |