Drugs present in MMsINC which are similar to the molecule MMscode: MMs00620998
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.79 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.79 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.75 |
MMs01724818 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.70 |
MMs01727442 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.70 |