Drugs present in MMsINC which are similar to the molecule MMscode: MMs00618877
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725063![]() | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.78 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.75 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.72 |
MMs01725067![]() | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725065![]() | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |