Drugs present in MMsINC which are similar to the molecule MMscode: MMs00598170
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.80 |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.80 |
MMs01725429![]() | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.78 |
MMs01725443![]() | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.78 |
MMs01725411![]() | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.77 |
MMs01725100![]() | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.75 |
MMs01725102![]() | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.75 |
MMs01726844![]() | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.75 |
MMs01726842![]() | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.75 |
MMs01724886![]() | S=C(N)c1cc(ncc1)CC | 0.75 |
MMs01726141![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01726143![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01726139![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01725141![]() | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01724773![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01725110![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.70 |



















