Drugs present in MMsINC which are similar to the molecule MMscode: MMs00589721
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.77 |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.72 |
MMs01727051 | ClC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)CCl)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01727053 | ClC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)CCl)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01727055 | ClC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)CCl)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01727056 | ClC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)CCl)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01725727 | ClC1(Cl)CC1c1ccc(OC(C(O)=O)(C)C)cc1 | 0.71 |