Drugs present in MMsINC which are similar to the molecule MMscode: MMs00547163
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.73 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725211![]() | Brc1ccc(cc1)C1(O)CCN(CC1)CCCC(=O)c1ccc(F)cc1 | 0.72 |
MMs01724898![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)C | 0.72 |
MMs01725592![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.71 |
MMs01725593![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.71 |









