Drugs present in MMsINC which are similar to the molecule MMscode: MMs00511727
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.85 |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.74 |
MMs01727387![]() | S(=O)(=O)(Nc1ncccc1)c1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1 | 0.71 |
MMs01724835![]() | O1c2c(cc(cc2)C(C)C)C(=O)c2cc(C(O)=O)c(nc12)N | 0.71 |
MMs01724881![]() | o1c(c(nc1N(CCO)CCO)-c1ccccc1)-c1ccccc1 | 0.71 |