Drugs present in MMsINC which are similar to the molecule MMscode: MMs00502229
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.78 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.78 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.77 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.76 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.76 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.76 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.74 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.74 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.74 |
MMs01727030 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.73 |
MMs01727029 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.73 |
MMs01727028 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.73 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.72 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.72 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.71 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.71 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01726106 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |
MMs01726108 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |