Drugs present in MMsINC which are similar to the molecule MMscode: MMs00497791
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.81 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725592![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.75 |
MMs01725593![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.75 |
MMs01726924![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.71 |
MMs01725221![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.71 |
MMs01725110![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |
MMs01724773![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.70 |
MMs01725336![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |