Drugs present in MMsINC which are similar to the molecule MMscode: MMs00482782
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727451![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.76 |
MMs01727455![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.76 |
MMs01727453![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.76 |
MMs01727449![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.76 |
MMs01725538![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01725828![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01725773![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.75 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.73 |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |




















