Drugs present in MMsINC which are similar to the molecule MMscode: MMs00482546
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725114 | SC(C(=O)NCC(O)=O)C | 0.77 |
MMs01727443 | SC(C(=O)NCC(O)=O)C | 0.77 |
MMs01726808 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.77 |
MMs01726810 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.77 |
MMs01726812 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.77 |
MMs01725381 | S1CC(NC1)C(O)=O | 0.71 |
MMs01725379 | S1CC(NC1)C(O)=O | 0.71 |